C16H28 — CID 174262023
5-pentyl-1,2-dipropylcyclopenta-1,3-diene (PubChem CID 174262023) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 5-pentyl-1,2-dipropylcyclopenta-1,3-diene.
| Compound Name | 5-pentyl-1,2-dipropylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 174262023 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 5-pentyl-1,2-dipropylcyclopenta-1,3-diene |
| SMILES | CCCCCC1C=CC(CCC)=C1CCC |
| InChI | InChI=1S/C16H28/c1-4-7-8-11-15-13-12-14(9-5-2)16(15)10-6-3/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | JKGJGTKUPQYLBQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|