C21H30Hf — CID 175279183
2,2-diethyl-5-pentyl-3,5-dihydro-1H-s-indacene;hafnium (PubChem CID 175279183) has the molecular formula C21H30Hf and a molecular weight of 460.96 g/mol. Its IUPAC name is 2,2-diethyl-5-pentyl-3,5-dihydro-1H-s-indacene;hafnium.
| Compound Name | 2,2-diethyl-5-pentyl-3,5-dihydro-1H-s-indacene;hafnium |
|---|---|
| PubChem CID | 175279183 |
| Molecular Formula | C21H30Hf |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2,2-diethyl-5-pentyl-3,5-dihydro-1H-s-indacene;hafnium |
| SMILES | CCCCCC1C=Cc2cc3c(cc21)CC(CC)(CC)C3.[Hf] |
| InChI | InChI=1S/C21H30.Hf/c1-4-7-8-9-16-10-11-17-12-18-14-21(5-2,6-3)15-19(18)13-20(16)17;/h10-13,16H,4-9,14-15H2,1-3H3; |
| InChIKey | WKPPPJUEJIPHNV-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|