C13H23P — CID 175870504
butyl-(2,3-diethylcyclopenta-2,4-dien-1-yl)phosphane (PubChem CID 175870504) has the molecular formula C13H23P and a molecular weight of 210.30 g/mol. Its IUPAC name is butyl-(2,3-diethylcyclopenta-2,4-dien-1-yl)phosphane.
| Compound Name | butyl-(2,3-diethylcyclopenta-2,4-dien-1-yl)phosphane |
|---|---|
| PubChem CID | 175870504 |
| Molecular Formula | C13H23P |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | butyl-(2,3-diethylcyclopenta-2,4-dien-1-yl)phosphane |
| SMILES | CCCCPC1C=CC(CC)=C1CC |
| InChI | InChI=1S/C13H23P/c1-4-7-10-14-13-9-8-11(5-2)12(13)6-3/h8-9,13-14H,4-7,10H2,1-3H3 |
| InChIKey | HYNYUPMFVJEEPP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|