C34H66Si4 — CID 101039931
1,1,3,3,5,5,7,7-octaethyl-2,6-dipentyl-2,6-dihydro-[1,3]disilolo[4,5-f][1,3]benzodisilole (PubChem CID 101039931) has the molecular formula C34H66Si4 and a molecular weight of 587.25 g/mol. Its IUPAC name is 1,1,3,3,5,5,7,7-octaethyl-2,6-dipentyl-2,6-dihydro-[1,3]disilolo[4,5-f][1,3]benzodisilole.
| Compound Name | 1,1,3,3,5,5,7,7-octaethyl-2,6-dipentyl-2,6-dihydro-[1,3]disilolo[4,5-f][1,3]benzodisilole |
|---|---|
| PubChem CID | 101039931 |
| Molecular Formula | C34H66Si4 |
| Molecular Weight | 587.25 g/mol |
| Exact Mass | 586.42 |
| IUPAC Name | 1,1,3,3,5,5,7,7-octaethyl-2,6-dipentyl-2,6-dihydro-[1,3]disilolo[4,5-f][1,3]benzodisilole |
| SMILES | CCCCCC1[Si](CC)(CC)c2cc3c(cc2[Si]1(CC)CC)[Si](CC)(CC)C(CCCCC)[Si]3(CC)CC |
| InChI | InChI=1S/C34H66Si4/c1-11-21-23-25-33-35(13-3,14-4)29-27-31-32(28-30(29)36(33,15-5)16-6)38(19-9,20-10)34(26-24-22-12-2)37(31,17-7)18-8/h27-28,33-34H,11-26H2,1-10H3 |
| InChIKey | WREGMDYUFSYFOW-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.25 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|