C22H32Ti — CID 22831435
carbanide;1-[2-[(1R)-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indene;titanium(2+) (PubChem CID 22831435) has the molecular formula C22H32Ti and a molecular weight of 344.37 g/mol. Its IUPAC name is carbanide;1-[2-[(1R)-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indene;titanium(2+).
| Compound Name | carbanide;1-[2-[(1R)-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indene;titanium(2+) |
|---|---|
| PubChem CID | 22831435 |
| Molecular Formula | C22H32Ti |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | carbanide;1-[2-[(1R)-4,5,6,7-tetrahydro-1H-inden-1-yl]ethyl]-4,5,6,7-tetrahydro-1H-indene;titanium(2+) |
| SMILES | C1=CC(CC[C@@H]2C=CC3=C2CCCC3)C2=C1CCCC2.[CH3-].[CH3-].[Ti+2] |
| InChI | InChI=1S/C20H26.2CH3.Ti/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h9-12,17-18H,1-8,13-14H2;2*1H3;/q;2*-1;+2/t17-,18?;;;/m0.../s1 |
| InChIKey | MAEZSWCSQXXAQO-HYFUBTONSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|