C14H20 — CID 178126161
1,2,3,3a,6,7,8,9,10,10b-decahydrocyclohepta[e]indene (PubChem CID 178126161) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is 1,2,3,3a,6,7,8,9,10,10b-decahydrocyclohepta[e]indene.
| Compound Name | 1,2,3,3a,6,7,8,9,10,10b-decahydrocyclohepta[e]indene |
|---|---|
| PubChem CID | 178126161 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1,2,3,3a,6,7,8,9,10,10b-decahydrocyclohepta[e]indene |
| SMILES | C1=CC2CCCC2C2=C1CCCCC2 |
| InChI | InChI=1S/C14H20/c1-2-5-11-9-10-12-6-4-8-14(12)13(11)7-3-1/h9-10,12,14H,1-8H2 |
| InChIKey | UKQMENADMIEQSE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |