C16H22 — CID 59819079
10-ethenyl-1,2,3,4,4a,5,6,7,8,10a-decahydrophenanthrene (PubChem CID 59819079) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 10-ethenyl-1,2,3,4,4a,5,6,7,8,10a-decahydrophenanthrene.
| Compound Name | 10-ethenyl-1,2,3,4,4a,5,6,7,8,10a-decahydrophenanthrene |
|---|---|
| PubChem CID | 59819079 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 10-ethenyl-1,2,3,4,4a,5,6,7,8,10a-decahydrophenanthrene |
| SMILES | C=CC1=CC2=C(CCCC2)C2CCCCC12 |
| InChI | InChI=1S/C16H22/c1-2-12-11-13-7-3-4-9-15(13)16-10-6-5-8-14(12)16/h2,11,14,16H,1,3-10H2 |
| InChIKey | XZZFZMXDYOGLQR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |