About 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene
3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene (PubChem CID 144533916) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene.
Analyze 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene?
The IUPAC name of 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene (CID 144533916) is 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene.
What is the SMILES notation for 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene?
The canonical SMILES for 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene is CC(C)C1=CC2=C(CC1)C(C)CC2.
What is the InChIKey of 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene?
The InChIKey is FYLMMNSHIRLRID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20/c1-9(2)11-6-7-13-10(3)4-5-12(13)8-11/h8-10H,4-7H2,1-3H3.
What are the key properties of 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene?
3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene has a molecular weight of 176.30 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6-propan-2-yl-2,3,4,5-tetrahydro-1H-indene is sourced from PubChem (CID 144533916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).