C20H32S — CID 144554041
1,4a,5-trimethyl-7-propan-2-yl-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-thiol (PubChem CID 144554041) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is 1,4a,5-trimethyl-7-propan-2-yl-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-thiol.
| Compound Name | 1,4a,5-trimethyl-7-propan-2-yl-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-thiol |
|---|---|
| PubChem CID | 144554041 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 1,4a,5-trimethyl-7-propan-2-yl-2,3,4,5,6,9,10,10a-octahydrophenanthrene-1-thiol |
| SMILES | CC(C)C1=CC2=C(C(C)C1)C1(C)CCCC(C)(S)C1CC2 |
| InChI | InChI=1S/C20H32S/c1-13(2)16-11-14(3)18-15(12-16)7-8-17-19(18,4)9-6-10-20(17,5)21/h12-14,17,21H,6-11H2,1-5H3 |
| InChIKey | NBJDFRMKWUHDRJ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|