C19H30O — CID 71577459
1-[(4bS)-4b,8,8-trimethyl-1,4,5,6,7,8a,9,10-octahydrophenanthren-2-yl]ethanol (PubChem CID 71577459) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-[(4bS)-4b,8,8-trimethyl-1,4,5,6,7,8a,9,10-octahydrophenanthren-2-yl]ethanol.
| Compound Name | 1-[(4bS)-4b,8,8-trimethyl-1,4,5,6,7,8a,9,10-octahydrophenanthren-2-yl]ethanol |
|---|---|
| PubChem CID | 71577459 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | 1-[(4bS)-4b,8,8-trimethyl-1,4,5,6,7,8a,9,10-octahydrophenanthren-2-yl]ethanol |
| SMILES | CC(O)C1=CCC2=C(CCC3C(C)(C)CCC[C@]23C)C1 |
| InChI | InChI=1S/C19H30O/c1-13(20)14-6-8-16-15(12-14)7-9-17-18(2,3)10-5-11-19(16,17)4/h6,13,17,20H,5,7-12H2,1-4H3/t13?,17?,19-/m1/s1 |
| InChIKey | MULPRSFJQPDHSZ-GFEPPQMASA-N |
| XLogP | 5.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|