C34H62 — CID 167512819
ethane;4,4,10,13,14-pentamethyl-17-(5-methyl-4-methylidenehexyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 167512819) has the molecular formula C34H62 and a molecular weight of 470.87 g/mol. Its IUPAC name is ethane;4,4,10,13,14-pentamethyl-17-(5-methyl-4-methylidenehexyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | ethane;4,4,10,13,14-pentamethyl-17-(5-methyl-4-methylidenehexyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 167512819 |
| Molecular Formula | C34H62 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.49 |
| IUPAC Name | ethane;4,4,10,13,14-pentamethyl-17-(5-methyl-4-methylidenehexyl)-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=C(CCCC1CCC2(C)C3=C(CCC12C)C1(C)CCCC(C)(C)C1CC3)C(C)C.CC.CC |
| InChI | InChI=1S/C30H50.2C2H6/c1-21(2)22(3)11-9-12-23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7;2*1-2/h21,23,26H,3,9-20H2,1-2,4-8H3;2*1-2H3 |
| InChIKey | CYCYCPQYUVHEAK-UHFFFAOYSA-N |
| XLogP | 11.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|