C33H52O5 — CID 118240892
[(10S,13R,14R,16R,17R)-17-(1-formyloxy-5-methyl-4-methylidenehexyl)-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl formate (PubChem CID 118240892) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is [(10S,13R,14R,16R,17R)-17-(1-formyloxy-5-methyl-4-methylidenehexyl)-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl formate.
| Compound Name | [(10S,13R,14R,16R,17R)-17-(1-formyloxy-5-methyl-4-methylidenehexyl)-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl formate |
|---|---|
| PubChem CID | 118240892 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | [(10S,13R,14R,16R,17R)-17-(1-formyloxy-5-methyl-4-methylidenehexyl)-16-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl]methyl formate |
| SMILES | C=C(CCC(OC=O)[C@H]1[C@H](O)C[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(COC=O)C(C)(C)C1CC3)C(C)C |
| InChI | InChI=1S/C33H52O5/c1-21(2)22(3)9-11-27(38-20-35)29-26(36)17-33(8)25-10-12-28-30(4,5)23(18-37-19-34)13-15-31(28,6)24(25)14-16-32(29,33)7/h19-21,23,26-29,36H,3,9-18H2,1-2,4-8H3/t23?,26-,27?,28?,29-,31-,32-,33+/m1/s1 |
| InChIKey | DMERNZYZESKUFP-IWAFAKKDSA-N |
| XLogP | 7.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|