C33H52O5 — CID 88848700
[(3S,5R,10S,13R,14R,15S,17S)-17-[(1R)-1-formyloxy-5-methyl-4-methylidenehexyl]-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-15-yl] acetate (PubChem CID 88848700) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is [(3S,5R,10S,13R,14R,15S,17S)-17-[(1R)-1-formyloxy-5-methyl-4-methylidenehexyl]-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-15-yl] acetate.
| Compound Name | [(3S,5R,10S,13R,14R,15S,17S)-17-[(1R)-1-formyloxy-5-methyl-4-methylidenehexyl]-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-15-yl] acetate |
|---|---|
| PubChem CID | 88848700 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | [(3S,5R,10S,13R,14R,15S,17S)-17-[(1R)-1-formyloxy-5-methyl-4-methylidenehexyl]-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-15-yl] acetate |
| SMILES | C=C(CC[C@@H](OC=O)[C@H]1C[C@H](OC(C)=O)[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3)C(C)C |
| InChI | InChI=1S/C33H52O5/c1-20(2)21(3)10-12-26(37-19-34)25-18-29(38-22(4)35)33(9)24-11-13-27-30(5,6)28(36)15-16-31(27,7)23(24)14-17-32(25,33)8/h19-20,25-29,36H,3,10-18H2,1-2,4-9H3/t25-,26-,27+,28+,29+,31-,32-,33-/m1/s1 |
| InChIKey | SLVUYEBPQSUSJL-JUNQSITQSA-N |
| XLogP | 7.17 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|