C20H24Cl2 — CID 140968404
2-chloro-1-[1-(2-chloro-4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene (PubChem CID 140968404) has the molecular formula C20H24Cl2 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-chloro-1-[1-(2-chloro-4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | 2-chloro-1-[1-(2-chloro-4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 140968404 |
| Molecular Formula | C20H24Cl2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-chloro-1-[1-(2-chloro-4,5,6,7-tetrahydro-1H-inden-1-yl)ethyl]-4,5,6,7-tetrahydro-1H-indene |
| SMILES | CC(C1C(Cl)=CC2=C1CCCC2)C1C(Cl)=CC2=C1CCCC2 |
| InChI | InChI=1S/C20H24Cl2/c1-12(19-15-8-4-2-6-13(15)10-17(19)21)20-16-9-5-3-7-14(16)11-18(20)22/h10-12,19-20H,2-9H2,1H3 |
| InChIKey | LYNBQXUCAVAUMU-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |