C22H30OSi — CID 19033178
2-dimethylsilylidene-1,1-bis(4,5,6,7-tetrahydro-1H-inden-1-yl)ethanol (PubChem CID 19033178) has the molecular formula C22H30OSi and a molecular weight of 338.57 g/mol. Its IUPAC name is 2-dimethylsilylidene-1,1-bis(4,5,6,7-tetrahydro-1H-inden-1-yl)ethanol.
| Compound Name | 2-dimethylsilylidene-1,1-bis(4,5,6,7-tetrahydro-1H-inden-1-yl)ethanol |
|---|---|
| PubChem CID | 19033178 |
| Molecular Formula | C22H30OSi |
| Molecular Weight | 338.57 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-dimethylsilylidene-1,1-bis(4,5,6,7-tetrahydro-1H-inden-1-yl)ethanol |
| SMILES | C[Si](C)=CC(O)(C1C=CC2=C1CCCC2)C1C=CC2=C1CCCC2 |
| InChI | InChI=1S/C22H30OSi/c1-24(2)15-22(23,20-13-11-16-7-3-5-9-18(16)20)21-14-12-17-8-4-6-10-19(17)21/h11-15,20-21,23H,3-10H2,1-2H3 |
| InChIKey | CHGMJAHSVHXTRR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|