C12H16 — CID 142973100
6-ethenyl-1,2,3,4,5,6-hexahydronaphthalene (PubChem CID 142973100) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is 6-ethenyl-1,2,3,4,5,6-hexahydronaphthalene.
| Compound Name | 6-ethenyl-1,2,3,4,5,6-hexahydronaphthalene |
|---|---|
| PubChem CID | 142973100 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 6-ethenyl-1,2,3,4,5,6-hexahydronaphthalene |
| SMILES | C=CC1C=CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C12H16/c1-2-10-7-8-11-5-3-4-6-12(11)9-10/h2,7-8,10H,1,3-6,9H2 |
| InChIKey | UPYZFKOYBKPZKV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|