C14H20O2 — CID 102483112
[(1S,2R,3S,4R)-7-cyclopentylidene-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol (PubChem CID 102483112) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-7-cyclopentylidene-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol.
| Compound Name | [(1S,2R,3S,4R)-7-cyclopentylidene-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
|---|---|
| PubChem CID | 102483112 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(1S,2R,3S,4R)-7-cyclopentylidene-3-(hydroxymethyl)-2-bicyclo[2.2.1]hept-5-enyl]methanol |
| SMILES | OC[C@@H]1[C@H](CO)[C@@H]2C=C[C@H]1C2=C1CCCC1 |
| InChI | InChI=1S/C14H20O2/c15-7-12-10-5-6-11(13(12)8-16)14(10)9-3-1-2-4-9/h5-6,10-13,15-16H,1-4,7-8H2/t10-,11+,12+,13- |
| InChIKey | NDBHWMLGIHNHPO-FNFFVJSTSA-N |
| XLogP | 1.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|