C21H20ClNO2 — CID 19915826
(1R,2R,6S,7R)-4-(4-chlorophenyl)-10-cyclohexylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 19915826) has the molecular formula C21H20ClNO2 and a molecular weight of 353.85 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-(4-chlorophenyl)-10-cyclohexylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-(4-chlorophenyl)-10-cyclohexylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 19915826 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | (1R,2R,6S,7R)-4-(4-chlorophenyl)-10-cyclohexylidene-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccc(Cl)cc1)[C@H]1C=C[C@H]2C1=C1CCCCC1 |
| InChI | InChI=1S/C21H20ClNO2/c22-13-6-8-14(9-7-13)23-20(24)18-15-10-11-16(19(18)21(23)25)17(15)12-4-2-1-3-5-12/h6-11,15-16,18-19H,1-5H2/t15-,16-,18-,19+/m0/s1 |
| InChIKey | WUYKWGBQZCUCIQ-PBWTXFEYSA-N |
| XLogP | 4.52 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|