C13H24SiTi — CID 173302708
carbanide;1,2,4,5,6,7-hexahydroinden-2-id-1-ylmethylsilane;titanium(4+) (PubChem CID 173302708) has the molecular formula C13H24SiTi and a molecular weight of 256.29 g/mol. Its IUPAC name is carbanide;1,2,4,5,6,7-hexahydroinden-2-id-1-ylmethylsilane;titanium(4+).
| Compound Name | carbanide;1,2,4,5,6,7-hexahydroinden-2-id-1-ylmethylsilane;titanium(4+) |
|---|---|
| PubChem CID | 173302708 |
| Molecular Formula | C13H24SiTi |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | carbanide;1,2,4,5,6,7-hexahydroinden-2-id-1-ylmethylsilane;titanium(4+) |
| SMILES | [CH3-].[CH3-].[CH3-].[SiH3]CC1[C-]=CC2=C1CCCC2.[Ti+4] |
| InChI | InChI=1S/C10H15Si.3CH3.Ti/c11-7-9-6-5-8-3-1-2-4-10(8)9;;;;/h5,9H,1-4,7H2,11H3;3*1H3;/q4*-1;+4 |
| InChIKey | QVUXXUVLCYFDME-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|