C11H12 — CID 123671849
6-methyl-2,3-dihydro-1H-azulene (PubChem CID 123671849) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is 6-methyl-2,3-dihydro-1H-azulene.
| Compound Name | 6-methyl-2,3-dihydro-1H-azulene |
|---|---|
| PubChem CID | 123671849 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 6-methyl-2,3-dihydro-1H-azulene |
| SMILES | CC1=C=CC2=C(C=C1)CCC2 |
| InChI | InChI=1S/C11H12/c1-9-5-7-10-3-2-4-11(10)8-6-9/h5,7-8H,2-4H2,1H3 |
| InChIKey | PCVCYWRNGMKUII-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |