C15H24 — CID 164574417
benzene;1,2-dimethylcyclopentene;ethane (PubChem CID 164574417) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is benzene;1,2-dimethylcyclopentene;ethane.
| Compound Name | benzene;1,2-dimethylcyclopentene;ethane |
|---|---|
| PubChem CID | 164574417 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | benzene;1,2-dimethylcyclopentene;ethane |
| SMILES | CC.CC1=C(C)CCC1.c1ccccc1 |
| InChI | InChI=1S/C7H12.C6H6.C2H6/c1-6-4-3-5-7(6)2;1-2-4-6-5-3-1;1-2/h3-5H2,1-2H3;1-6H;1-2H3 |
| InChIKey | DYAJVXDNTKKJFA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|