C40H56 — CID 159704202
2,3,7,8,14,15,19,20-octamethyl-25,26-di(propan-2-yl)tricyclo[19.3.1.19,13]hexacosa-1(25),2,7,9(26),10,12,14,19,21,23-decaene (PubChem CID 159704202) has the molecular formula C40H56 and a molecular weight of 536.89 g/mol. Its IUPAC name is 2,3,7,8,14,15,19,20-octamethyl-25,26-di(propan-2-yl)tricyclo[19.3.1.19,13]hexacosa-1(25),2,7,9(26),10,12,14,19,21,23-decaene.
| Compound Name | 2,3,7,8,14,15,19,20-octamethyl-25,26-di(propan-2-yl)tricyclo[19.3.1.19,13]hexacosa-1(25),2,7,9(26),10,12,14,19,21,23-decaene |
|---|---|
| PubChem CID | 159704202 |
| Molecular Formula | C40H56 |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 2,3,7,8,14,15,19,20-octamethyl-25,26-di(propan-2-yl)tricyclo[19.3.1.19,13]hexacosa-1(25),2,7,9(26),10,12,14,19,21,23-decaene |
| SMILES | CC1=C(C)c2cccc(c2C(C)C)C(C)=C(C)CCCC(C)=C(C)c2cccc(c2C(C)C)C(C)=C(C)CCC1 |
| InChI | InChI=1S/C40H56/c1-25(2)39-35-21-15-22-36(39)32(10)28(6)18-14-20-30(8)34(12)38-24-16-23-37(40(38)26(3)4)33(11)29(7)19-13-17-27(5)31(35)9/h15-16,21-26H,13-14,17-20H2,1-12H3 |
| InChIKey | AMRYULQOAMJTIE-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |