C13H16 — CID 10866804
1-methyl-3-(2-methylcyclopenten-1-yl)benzene (PubChem CID 10866804) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-methyl-3-(2-methylcyclopenten-1-yl)benzene.
| Compound Name | 1-methyl-3-(2-methylcyclopenten-1-yl)benzene |
|---|---|
| PubChem CID | 10866804 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-methyl-3-(2-methylcyclopenten-1-yl)benzene |
| SMILES | CC1=C(c2cccc(C)c2)CCC1 |
| InChI | InChI=1S/C13H16/c1-10-5-3-7-12(9-10)13-8-4-6-11(13)2/h3,5,7,9H,4,6,8H2,1-2H3 |
| InChIKey | FAGMODKEBOTPRD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |