C9H10 — CID 149382388
tricyclo[4.3.0.02,7]nona-1,6-diene (PubChem CID 149382388) has the molecular formula C9H10 and a molecular weight of 118.18 g/mol. Its IUPAC name is tricyclo[4.3.0.02,7]nona-1,6-diene.
| Compound Name | tricyclo[4.3.0.02,7]nona-1,6-diene |
|---|---|
| PubChem CID | 149382388 |
| Molecular Formula | C9H10 |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | tricyclo[4.3.0.02,7]nona-1,6-diene |
| SMILES | C1CC2=C3CCC2=C3C1 |
| InChI | InChI=1S/C9H10/c1-2-6-8-4-5-9(6)7(8)3-1/h1-5H2 |
| InChIKey | YLXHKKCAIGNHPK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |