C8H8N2O2 — CID 78176786
5,6,7,8-tetrahydrophthalazine-1,4-dione (PubChem CID 78176786) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 5,6,7,8-tetrahydrophthalazine-1,4-dione.
| Compound Name | 5,6,7,8-tetrahydrophthalazine-1,4-dione |
|---|---|
| PubChem CID | 78176786 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 5,6,7,8-tetrahydrophthalazine-1,4-dione |
| SMILES | O=C1N=NC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C8H8N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H2 |
| InChIKey | DVMQMAJYNQLBIC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |