C7H6N2O2 — CID 138059176
6,7-dihydro-5H-cyclopenta[c]pyridazine-3,4-dione (PubChem CID 138059176) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 6,7-dihydro-5H-cyclopenta[c]pyridazine-3,4-dione.
| Compound Name | 6,7-dihydro-5H-cyclopenta[c]pyridazine-3,4-dione |
|---|---|
| PubChem CID | 138059176 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 6,7-dihydro-5H-cyclopenta[c]pyridazine-3,4-dione |
| SMILES | O=C1N=NC2=C(CCC2)C1=O |
| InChI | InChI=1S/C7H6N2O2/c10-6-4-2-1-3-5(4)8-9-7(6)11/h1-3H2 |
| InChIKey | NUESHSGIPLSUBM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|