About 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole
3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole (PubChem CID 59820667) has the molecular formula C8H9N
and a molecular weight of 119.17 g/mol. Its IUPAC name is 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole.
Analyze 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The IUPAC name of 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole (CID 59820667) is 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole.
What is the SMILES notation for 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The canonical SMILES for 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole is C=C1C=NC2=C1CCC2.
What is the InChIKey of 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole?
The InChIKey is RCQYQXHAQPDIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N/c1-6-5-9-8-4-2-3-7(6)8/h5H,1-4H2.
What are the key properties of 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole?
3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole has a molecular weight of 119.17 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-5,6-dihydro-4H-cyclopenta[b]pyrrole is sourced from PubChem (CID 59820667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).