C21H38OSi2 — CID 102444280
1,3-bis[tert-butyl(dimethyl)silyl]-4,5,6,7-tetrahydroinden-2-one (PubChem CID 102444280) has the molecular formula C21H38OSi2 and a molecular weight of 362.71 g/mol. Its IUPAC name is 1,3-bis[tert-butyl(dimethyl)silyl]-4,5,6,7-tetrahydroinden-2-one.
| Compound Name | 1,3-bis[tert-butyl(dimethyl)silyl]-4,5,6,7-tetrahydroinden-2-one |
|---|---|
| PubChem CID | 102444280 |
| Molecular Formula | C21H38OSi2 |
| Molecular Weight | 362.71 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1,3-bis[tert-butyl(dimethyl)silyl]-4,5,6,7-tetrahydroinden-2-one |
| SMILES | CC(C)(C)[Si](C)(C)C1=C2CCCCC2=C([Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C21H38OSi2/c1-20(2,3)23(7,8)18-15-13-11-12-14-16(15)19(17(18)22)24(9,10)21(4,5)6/h11-14H2,1-10H3 |
| InChIKey | MDYCBRQQCIZUHO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.71 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|