C9H11NO2 — CID 59947083
3-methylimino-4,5,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 59947083) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-methylimino-4,5,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | 3-methylimino-4,5,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 59947083 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-methylimino-4,5,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | C/N=C1\OC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C9H11NO2/c1-10-8-6-4-2-3-5-7(6)9(11)12-8/h2-5H2,1H3/b10-8- |
| InChIKey | YAGNTILLPQXEAR-NTMALXAHSA-N |
| XLogP | 1.44 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|