C14H22N2O5 — CID 175161415
2,6-diaminohexanoic acid;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 175161415) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2,6-diaminohexanoic acid;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 2,6-diaminohexanoic acid;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 175161415 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2,6-diaminohexanoic acid;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | NCCCCC(N)C(=O)O.O=C1OC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C8H8O3.C6H14N2O2/c9-7-5-3-1-2-4-6(5)8(10)11-7;7-4-2-1-3-5(8)6(9)10/h1-4H2;5H,1-4,7-8H2,(H,9,10) |
| InChIKey | XYTQZRVEGZBACZ-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|