C13H18 — CID 151775012
2-butyl-5-cyclobutylidenecyclopenta-1,3-diene (PubChem CID 151775012) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-butyl-5-cyclobutylidenecyclopenta-1,3-diene.
| Compound Name | 2-butyl-5-cyclobutylidenecyclopenta-1,3-diene |
|---|---|
| PubChem CID | 151775012 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-butyl-5-cyclobutylidenecyclopenta-1,3-diene |
| SMILES | CCCCC1=CC(=C2CCC2)C=C1 |
| InChI | InChI=1S/C13H18/c1-2-3-5-11-8-9-13(10-11)12-6-4-7-12/h8-10H,2-7H2,1H3 |
| InChIKey | RTKBDYNPIUASJU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |