C15H26Si — CID 173079960
(3-butylcyclopenta-2,4-dien-1-ylidene)-methyl-pentylsilane (PubChem CID 173079960) has the molecular formula C15H26Si and a molecular weight of 234.46 g/mol. Its IUPAC name is (3-butylcyclopenta-2,4-dien-1-ylidene)-methyl-pentylsilane.
| Compound Name | (3-butylcyclopenta-2,4-dien-1-ylidene)-methyl-pentylsilane |
|---|---|
| PubChem CID | 173079960 |
| Molecular Formula | C15H26Si |
| Molecular Weight | 234.46 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | (3-butylcyclopenta-2,4-dien-1-ylidene)-methyl-pentylsilane |
| SMILES | CCCCC[Si](C)=C1C=CC(CCCC)=C1 |
| InChI | InChI=1S/C15H26Si/c1-4-6-8-12-16(3)15-11-10-14(13-15)9-7-5-2/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | WAMKTCGUTQRFBS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|