C17H30 — CID 175604170
octane;4,5,6,7-tetrahydro-1H-indene (PubChem CID 175604170) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is octane;4,5,6,7-tetrahydro-1H-indene.
| Compound Name | octane;4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 175604170 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | octane;4,5,6,7-tetrahydro-1H-indene |
| SMILES | C1=CC2=C(C1)CCCC2.CCCCCCCC |
| InChI | InChI=1S/C9H12.C8H18/c1-2-5-9-7-3-6-8(9)4-1;1-3-5-7-8-6-4-2/h3,6H,1-2,4-5,7H2;3-8H2,1-2H3 |
| InChIKey | HEPRTPCOKIIJPM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|