C22H35N3 — CID 145091846
heptane;1-methyl-6-(1-methylpyrazol-3-yl)-2,3,4,7-tetrahydrocyclohepta[b]pyridine (PubChem CID 145091846) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is heptane;1-methyl-6-(1-methylpyrazol-3-yl)-2,3,4,7-tetrahydrocyclohepta[b]pyridine.
| Compound Name | heptane;1-methyl-6-(1-methylpyrazol-3-yl)-2,3,4,7-tetrahydrocyclohepta[b]pyridine |
|---|---|
| PubChem CID | 145091846 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | heptane;1-methyl-6-(1-methylpyrazol-3-yl)-2,3,4,7-tetrahydrocyclohepta[b]pyridine |
| SMILES | CCCCCCC.CN1CCCC2=C1C=CCC(c1ccn(C)n1)=C2 |
| InChI | InChI=1S/C15H19N3.C7H16/c1-17-9-4-6-13-11-12(5-3-7-15(13)17)14-8-10-18(2)16-14;1-3-5-7-6-4-2/h3,7-8,10-11H,4-6,9H2,1-2H3;3-7H2,1-2H3 |
| InChIKey | FHZJUFWICOCNGX-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|