C22H34Si2 — CID 101245241
[dimethyl(4,5,6,7-tetrahydro-1H-inden-2-yl)silyl]-dimethyl-(4,5,6,7-tetrahydro-1H-inden-2-yl)silane (PubChem CID 101245241) has the molecular formula C22H34Si2 and a molecular weight of 354.69 g/mol. Its IUPAC name is [dimethyl(4,5,6,7-tetrahydro-1H-inden-2-yl)silyl]-dimethyl-(4,5,6,7-tetrahydro-1H-inden-2-yl)silane.
| Compound Name | [dimethyl(4,5,6,7-tetrahydro-1H-inden-2-yl)silyl]-dimethyl-(4,5,6,7-tetrahydro-1H-inden-2-yl)silane |
|---|---|
| PubChem CID | 101245241 |
| Molecular Formula | C22H34Si2 |
| Molecular Weight | 354.69 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [dimethyl(4,5,6,7-tetrahydro-1H-inden-2-yl)silyl]-dimethyl-(4,5,6,7-tetrahydro-1H-inden-2-yl)silane |
| SMILES | C[Si](C)(C1=CC2=C(CCCC2)C1)[Si](C)(C)C1=CC2=C(CCCC2)C1 |
| InChI | InChI=1S/C22H34Si2/c1-23(2,21-13-17-9-5-6-10-18(17)14-21)24(3,4)22-15-19-11-7-8-12-20(19)16-22/h13,15H,5-12,14,16H2,1-4H3 |
| InChIKey | ZKEIMMPNZNGDGL-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|