C10H14S — CID 130336361
3,4,5,6,7,8-hexahydronaphthalene-2-thiol (PubChem CID 130336361) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is 3,4,5,6,7,8-hexahydronaphthalene-2-thiol.
| Compound Name | 3,4,5,6,7,8-hexahydronaphthalene-2-thiol |
|---|---|
| PubChem CID | 130336361 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 3,4,5,6,7,8-hexahydronaphthalene-2-thiol |
| SMILES | SC1=CC2=C(CCCC2)CC1 |
| InChI | InChI=1S/C10H14S/c11-10-6-5-8-3-1-2-4-9(8)7-10/h7,11H,1-6H2 |
| InChIKey | VTZMDYSCPFTDHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|