C18H21NO — CID 143862250
7-methyl-1,3,4,5-tetrahydrocyclohepta[b]pyridin-2-one;toluene (PubChem CID 143862250) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 7-methyl-1,3,4,5-tetrahydrocyclohepta[b]pyridin-2-one;toluene.
| Compound Name | 7-methyl-1,3,4,5-tetrahydrocyclohepta[b]pyridin-2-one;toluene |
|---|---|
| PubChem CID | 143862250 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 7-methyl-1,3,4,5-tetrahydrocyclohepta[b]pyridin-2-one;toluene |
| SMILES | CC1=CCC2=C(C=C1)NC(=O)CC2.Cc1ccccc1 |
| InChI | InChI=1S/C11H13NO.C7H8/c1-8-2-4-9-5-7-11(13)12-10(9)6-3-8;1-7-5-3-2-4-6-7/h2-3,6H,4-5,7H2,1H3,(H,12,13);2-6H,1H3 |
| InChIKey | AVSPFNCFEHTMNV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |