C23H31N5O2 — CID 136598261
(3E)-3-hydroxyimino-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1,2-dihydroinden-5-ol (PubChem CID 136598261) has the molecular formula C23H31N5O2 and a molecular weight of 409.53 g/mol. Its IUPAC name is (3E)-3-hydroxyimino-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1,2-dihydroinden-5-ol.
| Compound Name | (3E)-3-hydroxyimino-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1,2-dihydroinden-5-ol |
|---|---|
| PubChem CID | 136598261 |
| Molecular Formula | C23H31N5O2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | (3E)-3-hydroxyimino-6-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridazin-3-yl]-1,2-dihydroinden-5-ol |
| SMILES | CN(c1ccc(-c2cc3c(cc2O)/C(=N/O)CC3)nn1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H31N5O2/c1-22(2)12-15(13-23(3,4)27-22)28(5)21-9-8-18(24-25-21)17-10-14-6-7-19(26-30)16(14)11-20(17)29/h8-11,15,27,29-30H,6-7,12-13H2,1-5H3/b26-19+ |
| InChIKey | ZPIQOPDDEXWDPB-LGUFXXKBSA-N |
| XLogP | 3.72 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|