C22H28IN7O3S2 — CID 136598602
N-[1-(dimethylamino)-3-[[2-(hydroxyamino)-2-[4-(iodomethyl)phenyl]iminoethanethioyl]amino]-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 136598602) has the molecular formula C22H28IN7O3S2 and a molecular weight of 629.55 g/mol. Its IUPAC name is N-[1-(dimethylamino)-3-[[2-(hydroxyamino)-2-[4-(iodomethyl)phenyl]iminoethanethioyl]amino]-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[1-(dimethylamino)-3-[[2-(hydroxyamino)-2-[4-(iodomethyl)phenyl]iminoethanethioyl]amino]-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 136598602 |
| Molecular Formula | C22H28IN7O3S2 |
| Molecular Weight | 629.55 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | N-[1-(dimethylamino)-3-[[2-(hydroxyamino)-2-[4-(iodomethyl)phenyl]iminoethanethioyl]amino]-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)NC(CNC(=S)/C(=N/c3ccc(CI)cc3)NO)C(=O)N(C)C)sc2C1 |
| InChI | InChI=1S/C22H28IN7O3S2/c1-29(2)22(32)16(26-19(31)21-27-15-8-9-30(3)12-17(15)35-21)11-24-20(34)18(28-33)25-14-6-4-13(10-23)5-7-14/h4-7,16,33H,8-12H2,1-3H3,(H,24,34)(H,25,28)(H,26,31) |
| InChIKey | ACHLKRLNPDHDQC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 122.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|