C21H24ClN7O5S2 — CID 58893716
N-[3-[[2-(4-chloro-3-nitroanilino)-2-oxoethanethioyl]amino]-1-(dimethylamino)-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 58893716) has the molecular formula C21H24ClN7O5S2 and a molecular weight of 554.05 g/mol. Its IUPAC name is N-[3-[[2-(4-chloro-3-nitroanilino)-2-oxoethanethioyl]amino]-1-(dimethylamino)-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[3-[[2-(4-chloro-3-nitroanilino)-2-oxoethanethioyl]amino]-1-(dimethylamino)-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 58893716 |
| Molecular Formula | C21H24ClN7O5S2 |
| Molecular Weight | 554.05 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | N-[3-[[2-(4-chloro-3-nitroanilino)-2-oxoethanethioyl]amino]-1-(dimethylamino)-1-oxopropan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)NC(CNC(=S)C(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)C(=O)N(C)C)sc2C1 |
| InChI | InChI=1S/C21H24ClN7O5S2/c1-27(2)21(32)14(25-18(31)20-26-13-6-7-28(3)10-16(13)36-20)9-23-19(35)17(30)24-11-4-5-12(22)15(8-11)29(33)34/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,23,35)(H,24,30)(H,25,31) |
| InChIKey | LFCSFSYOXHUEKM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 149.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.05 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|