C19H17BrFN5O — CID 136599502
6-bromo-3-(6-fluoro-1H-benzimidazol-2-yl)-4-[2-(methylamino)ethylamino]-1H-quinolin-2-one (PubChem CID 136599502) has the molecular formula C19H17BrFN5O and a molecular weight of 430.28 g/mol. Its IUPAC name is 6-bromo-3-(6-fluoro-1H-benzimidazol-2-yl)-4-[2-(methylamino)ethylamino]-1H-quinolin-2-one.
| Compound Name | 6-bromo-3-(6-fluoro-1H-benzimidazol-2-yl)-4-[2-(methylamino)ethylamino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 136599502 |
| Molecular Formula | C19H17BrFN5O |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 6-bromo-3-(6-fluoro-1H-benzimidazol-2-yl)-4-[2-(methylamino)ethylamino]-1H-quinolin-2-one |
| SMILES | CNCCNc1c(-c2nc3ccc(F)cc3[nH]2)c(=O)[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C19H17BrFN5O/c1-22-6-7-23-17-12-8-10(20)2-4-13(12)26-19(27)16(17)18-24-14-5-3-11(21)9-15(14)25-18/h2-5,8-9,22H,6-7H2,1H3,(H,24,25)(H2,23,26,27) |
| InChIKey | VBDUCTICQBQXMO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|