C21H24N6OS — CID 166802755
4-(cyclobutylamino)-3-[6-[2-(methylamino)ethylamino]-1H-benzimidazol-2-yl]-1H-thieno[3,4-b]pyridin-2-one (PubChem CID 166802755) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 4-(cyclobutylamino)-3-[6-[2-(methylamino)ethylamino]-1H-benzimidazol-2-yl]-1H-thieno[3,4-b]pyridin-2-one.
| Compound Name | 4-(cyclobutylamino)-3-[6-[2-(methylamino)ethylamino]-1H-benzimidazol-2-yl]-1H-thieno[3,4-b]pyridin-2-one |
|---|---|
| PubChem CID | 166802755 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-(cyclobutylamino)-3-[6-[2-(methylamino)ethylamino]-1H-benzimidazol-2-yl]-1H-thieno[3,4-b]pyridin-2-one |
| SMILES | CNCCNc1ccc2nc(-c3c(NC4CCC4)c4cscc4[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C21H24N6OS/c1-22-7-8-23-13-5-6-15-16(9-13)26-20(25-15)18-19(24-12-3-2-4-12)14-10-29-11-17(14)27-21(18)28/h5-6,9-12,22-24H,2-4,7-8H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | OEVRKSFNCKMCRB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|