C26H27ClN2O5S — CID 136601978
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136601978) has the molecular formula C26H27ClN2O5S and a molecular weight of 515.03 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136601978 |
| Molecular Formula | C26H27ClN2O5S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ccsc4c(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C26H27ClN2O5S/c1-33-21-7-6-15(12-18(21)27)8-10-26(16-4-2-3-5-16)14-20(30)17(25(32)34-26)13-22-28-19-9-11-35-23(19)24(31)29-22/h6-7,9,11-12,16-17H,2-5,8,10,13-14H2,1H3,(H,28,29,31) |
| InChIKey | JECGDBYZUCTRAU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|