C28H29ClN2O5 — CID 136652625
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136652625) has the molecular formula C28H29ClN2O5 and a molecular weight of 509.00 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136652625 |
| Molecular Formula | C28H29ClN2O5 |
| Molecular Weight | 509.00 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ccccc4c(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C28H29ClN2O5/c1-35-24-11-10-17(14-21(24)29)12-13-28(18-6-2-3-7-18)16-23(32)20(27(34)36-28)15-25-30-22-9-5-4-8-19(22)26(33)31-25/h4-5,8-11,14,18,20H,2-3,6-7,12-13,15-16H2,1H3,(H,30,31,33) |
| InChIKey | NTRKZJVFGCQJPF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.00 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|