C29H31ClN2O6 — CID 136502095
6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136502095) has the molecular formula C29H31ClN2O6 and a molecular weight of 539.03 g/mol. Its IUPAC name is 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136502095 |
| Molecular Formula | C29H31ClN2O6 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 6-[2-(5-chloro-2,4-dimethoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-oxo-3H-quinazolin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1cc(OC)c(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ccccc4c(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C29H31ClN2O6/c1-36-24-15-25(37-2)21(30)13-17(24)11-12-29(18-7-3-4-8-18)16-23(33)20(28(35)38-29)14-26-31-22-10-6-5-9-19(22)27(34)32-26/h5-6,9-10,13,15,18,20H,3-4,7-8,11-12,14,16H2,1-2H3,(H,31,32,34) |
| InChIKey | GQOYGAWOHZVWCI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 107.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|