C25H29ClN2O5 — CID 136633342
6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)methyl]oxane-2,4-dione (PubChem CID 136633342) has the molecular formula C25H29ClN2O5 and a molecular weight of 472.97 g/mol. Its IUPAC name is 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)methyl]oxane-2,4-dione.
| Compound Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)methyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 136633342 |
| Molecular Formula | C25H29ClN2O5 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 6-[2-(3-chloro-4-methoxyphenyl)ethyl]-6-cyclopentyl-3-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)methyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc(C)cc(=O)[nH]3)C(=O)O2)cc1Cl |
| InChI | InChI=1S/C25H29ClN2O5/c1-15-11-23(30)28-22(27-15)13-18-20(29)14-25(33-24(18)31,17-5-3-4-6-17)10-9-16-7-8-21(32-2)19(26)12-16/h7-8,11-12,17-18H,3-6,9-10,13-14H2,1-2H3,(H,27,28,30) |
| InChIKey | YWXGVBSEYIVAAR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 98.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|