C19H19N5O3S — CID 136603347
2-[(2,4-dimethoxyanilino)methyl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 136603347) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyanilino)methyl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(2,4-dimethoxyanilino)methyl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136603347 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[(2,4-dimethoxyanilino)methyl]-6-(5-methyl-1H-pyrazol-4-yl)-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ccc(NCc2nc3cc(-c4cn[nH]c4C)sc3c(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C19H19N5O3S/c1-10-12(8-21-24-10)16-7-14-18(28-16)19(25)23-17(22-14)9-20-13-5-4-11(26-2)6-15(13)27-3/h4-8,20H,9H2,1-3H3,(H,21,24)(H,22,23,25) |
| InChIKey | RCEFQPCBFHESIX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|