C9H14N6O2S — CID 136603859
1,4-dioxido-2-N-(thiophen-2-ylmethyl)-2,5-dihydropyrazine-1,4-diium-2,3,5,6-tetramine (PubChem CID 136603859) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is 1,4-dioxido-2-N-(thiophen-2-ylmethyl)-2,5-dihydropyrazine-1,4-diium-2,3,5,6-tetramine.
| Compound Name | 1,4-dioxido-2-N-(thiophen-2-ylmethyl)-2,5-dihydropyrazine-1,4-diium-2,3,5,6-tetramine |
|---|---|
| PubChem CID | 136603859 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 1,4-dioxido-2-N-(thiophen-2-ylmethyl)-2,5-dihydropyrazine-1,4-diium-2,3,5,6-tetramine |
| SMILES | NC1=[N+]([O-])C(N)C(N)=[N+]([O-])C1NCc1cccs1 |
| InChI | InChI=1S/C9H14N6O2S/c10-6-7(11)15(17)9(8(12)14(6)16)13-4-5-2-1-3-18-5/h1-3,6,9,13H,4,10-12H2 |
| InChIKey | FYQAJNYAXZKASC-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 142.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|