C14H24N4O2S2 — CID 57289950
N'-[2-[[5-[1-(ethylamino)ethyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide (PubChem CID 57289950) has the molecular formula C14H24N4O2S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is N'-[2-[[5-[1-(ethylamino)ethyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide.
| Compound Name | N'-[2-[[5-[1-(ethylamino)ethyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
|---|---|
| PubChem CID | 57289950 |
| Molecular Formula | C14H24N4O2S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N'-[2-[[5-[1-(ethylamino)ethyl]thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
| SMILES | CCNC(C)c1ccc(CSCC/N=C(\N)C(C)[N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H24N4O2S2/c1-4-16-10(2)13-6-5-12(22-13)9-21-8-7-17-14(15)11(3)18(19)20/h5-6,10-11,16H,4,7-9H2,1-3H3,(H2,15,17) |
| InChIKey | WYRZYQRCVIUZQJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|