C16H24N4O2S2 — CID 54117855
4-nitro-N-[2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 54117855) has the molecular formula C16H24N4O2S2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 4-nitro-N-[2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | 4-nitro-N-[2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 54117855 |
| Molecular Formula | C16H24N4O2S2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-nitro-N-[2-[[5-(pyrrolidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | O=[N+]([O-])C1CCN=C1NCCSCc1ccc(CN2CCCC2)s1 |
| InChI | InChI=1S/C16H24N4O2S2/c21-20(22)15-5-6-17-16(15)18-7-10-23-12-14-4-3-13(24-14)11-19-8-1-2-9-19/h3-4,15H,1-2,5-12H2,(H,17,18) |
| InChIKey | NLPOLEBRRSZQHV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|